C24H43NO2Si — CID 102046467
4-phenyl-2-triethylsilyloxy-N-(2,4,4-trimethylpentan-2-yl)butanamide (PubChem CID 102046467) has the molecular formula C24H43NO2Si and a molecular weight of 405.70 g/mol. Its IUPAC name is 4-phenyl-2-triethylsilyloxy-N-(2,4,4-trimethylpentan-2-yl)butanamide.
| Compound Name | 4-phenyl-2-triethylsilyloxy-N-(2,4,4-trimethylpentan-2-yl)butanamide |
|---|---|
| PubChem CID | 102046467 |
| Molecular Formula | C24H43NO2Si |
| Molecular Weight | 405.70 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | 4-phenyl-2-triethylsilyloxy-N-(2,4,4-trimethylpentan-2-yl)butanamide |
| SMILES | CC[Si](CC)(CC)OC(CCc1ccccc1)C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C24H43NO2Si/c1-9-28(10-2,11-3)27-21(18-17-20-15-13-12-14-16-20)22(26)25-24(7,8)19-23(4,5)6/h12-16,21H,9-11,17-19H2,1-8H3,(H,25,26) |
| InChIKey | HWMPTQFXVHPEHJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|