C24H33NO3P+ — CID 135064193
oxo-[1-oxo-4-phenyl-1-(2,4,4-trimethylpentan-2-ylamino)butan-2-yl]oxy-phenylphosphanium (PubChem CID 135064193) has the molecular formula C24H33NO3P+ and a molecular weight of 414.51 g/mol. Its IUPAC name is oxo-[1-oxo-4-phenyl-1-(2,4,4-trimethylpentan-2-ylamino)butan-2-yl]oxy-phenylphosphanium.
| Compound Name | oxo-[1-oxo-4-phenyl-1-(2,4,4-trimethylpentan-2-ylamino)butan-2-yl]oxy-phenylphosphanium |
|---|---|
| PubChem CID | 135064193 |
| Molecular Formula | C24H33NO3P+ |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | oxo-[1-oxo-4-phenyl-1-(2,4,4-trimethylpentan-2-ylamino)butan-2-yl]oxy-phenylphosphanium |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)C(CCc1ccccc1)O[P+](=O)c1ccccc1 |
| InChI | InChI=1S/C24H32NO3P/c1-23(2,3)18-24(4,5)25-22(26)21(17-16-19-12-8-6-9-13-19)28-29(27)20-14-10-7-11-15-20/h6-15,21H,16-18H2,1-5H3/p+1 |
| InChIKey | JTSZZQAHUITZHE-UHFFFAOYSA-O |
| XLogP | 5.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|