C18H27NO3P+ — CID 135065508
[2-(tert-butylamino)-1-cyclohexyl-2-oxoethoxy]-oxo-phenylphosphanium (PubChem CID 135065508) has the molecular formula C18H27NO3P+ and a molecular weight of 336.39 g/mol. Its IUPAC name is [2-(tert-butylamino)-1-cyclohexyl-2-oxoethoxy]-oxo-phenylphosphanium.
| Compound Name | [2-(tert-butylamino)-1-cyclohexyl-2-oxoethoxy]-oxo-phenylphosphanium |
|---|---|
| PubChem CID | 135065508 |
| Molecular Formula | C18H27NO3P+ |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [2-(tert-butylamino)-1-cyclohexyl-2-oxoethoxy]-oxo-phenylphosphanium |
| SMILES | CC(C)(C)NC(=O)C(O[P+](=O)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C18H26NO3P/c1-18(2,3)19-17(20)16(14-10-6-4-7-11-14)22-23(21)15-12-8-5-9-13-15/h5,8-9,12-14,16H,4,6-7,10-11H2,1-3H3/p+1 |
| InChIKey | KTTHXCKMOIIINM-UHFFFAOYSA-O |
| XLogP | 3.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|