C22H27NO3P+ — CID 135064623
[1-(cyclohexylamino)-1-oxo-4-phenylbutan-2-yl]oxy-oxo-phenylphosphanium (PubChem CID 135064623) has the molecular formula C22H27NO3P+ and a molecular weight of 384.44 g/mol. Its IUPAC name is [1-(cyclohexylamino)-1-oxo-4-phenylbutan-2-yl]oxy-oxo-phenylphosphanium.
| Compound Name | [1-(cyclohexylamino)-1-oxo-4-phenylbutan-2-yl]oxy-oxo-phenylphosphanium |
|---|---|
| PubChem CID | 135064623 |
| Molecular Formula | C22H27NO3P+ |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | [1-(cyclohexylamino)-1-oxo-4-phenylbutan-2-yl]oxy-oxo-phenylphosphanium |
| SMILES | O=C(NC1CCCCC1)C(CCc1ccccc1)O[P+](=O)c1ccccc1 |
| InChI | InChI=1S/C22H26NO3P/c24-22(23-19-12-6-2-7-13-19)21(17-16-18-10-4-1-5-11-18)26-27(25)20-14-8-3-9-15-20/h1,3-5,8-11,14-15,19,21H,2,6-7,12-13,16-17H2/p+1 |
| InChIKey | NSOCSBPWOYUQCX-UHFFFAOYSA-O |
| XLogP | 4.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|