C20H24NO6P — CID 14855943
3-[[2-[hydroxy(2-phenylethyl)phosphoryl]oxy-3-phenylpropanoyl]amino]propanoic acid (PubChem CID 14855943) has the molecular formula C20H24NO6P and a molecular weight of 405.39 g/mol. Its IUPAC name is 3-[[2-[hydroxy(2-phenylethyl)phosphoryl]oxy-3-phenylpropanoyl]amino]propanoic acid.
| Compound Name | 3-[[2-[hydroxy(2-phenylethyl)phosphoryl]oxy-3-phenylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 14855943 |
| Molecular Formula | C20H24NO6P |
| Molecular Weight | 405.39 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 3-[[2-[hydroxy(2-phenylethyl)phosphoryl]oxy-3-phenylpropanoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C(Cc1ccccc1)OP(=O)(O)CCc1ccccc1 |
| InChI | InChI=1S/C20H24NO6P/c22-19(23)11-13-21-20(24)18(15-17-9-5-2-6-10-17)27-28(25,26)14-12-16-7-3-1-4-8-16/h1-10,18H,11-15H2,(H,21,24)(H,22,23)(H,25,26) |
| InChIKey | RDOUPIADSAQBRY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|