C28H39N2O6P — CID 14630745
(2S,4S)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-benzylpyrrolidine-2-carboxylic acid (PubChem CID 14630745) has the molecular formula C28H39N2O6P and a molecular weight of 530.60 g/mol. Its IUPAC name is (2S,4S)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-benzylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-benzylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14630745 |
| Molecular Formula | C28H39N2O6P |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | (2S,4S)-1-[(2S)-6-amino-2-[hydroxy(4-phenylbutyl)phosphoryl]oxyhexanoyl]-4-benzylpyrrolidine-2-carboxylic acid |
| SMILES | NCCCC[C@H](OP(=O)(O)CCCCc1ccccc1)C(=O)N1C[C@@H](Cc2ccccc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C28H39N2O6P/c29-17-9-7-16-26(36-37(34,35)18-10-8-13-22-11-3-1-4-12-22)27(31)30-21-24(20-25(30)28(32)33)19-23-14-5-2-6-15-23/h1-6,11-12,14-15,24-26H,7-10,13,16-21,29H2,(H,32,33)(H,34,35)/t24-,25-,26-/m0/s1 |
| InChIKey | JHACRDJKRXAJTL-GSDHBNRESA-N |
| XLogP | 4.25 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|