C22H28NO6P — CID 14855950
3-[[2-[hydroxy(4-phenylbutyl)phosphoryl]oxy-3-phenylpropanoyl]amino]propanoic acid (PubChem CID 14855950) has the molecular formula C22H28NO6P and a molecular weight of 433.44 g/mol. Its IUPAC name is 3-[[2-[hydroxy(4-phenylbutyl)phosphoryl]oxy-3-phenylpropanoyl]amino]propanoic acid.
| Compound Name | 3-[[2-[hydroxy(4-phenylbutyl)phosphoryl]oxy-3-phenylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 14855950 |
| Molecular Formula | C22H28NO6P |
| Molecular Weight | 433.44 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 3-[[2-[hydroxy(4-phenylbutyl)phosphoryl]oxy-3-phenylpropanoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C(Cc1ccccc1)OP(=O)(O)CCCCc1ccccc1 |
| InChI | InChI=1S/C22H28NO6P/c24-21(25)14-15-23-22(26)20(17-19-12-5-2-6-13-19)29-30(27,28)16-8-7-11-18-9-3-1-4-10-18/h1-6,9-10,12-13,20H,7-8,11,14-17H2,(H,23,26)(H,24,25)(H,27,28) |
| InChIKey | ZFDIXRMRTODLFR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|