C29H49N2O6P — CID 10099128
[(2R)-1-[[(2S,3S,5R)-6-(butylamino)-1-cyclohexyl-3-hydroxy-5-methyl-6-oxohexan-2-yl]amino]-1-oxopropan-2-yl]oxy-(3-phenylpropyl)phosphinic acid (PubChem CID 10099128) has the molecular formula C29H49N2O6P and a molecular weight of 552.69 g/mol. Its IUPAC name is [(2R)-1-[[(2S,3S,5R)-6-(butylamino)-1-cyclohexyl-3-hydroxy-5-methyl-6-oxohexan-2-yl]amino]-1-oxopropan-2-yl]oxy-(3-phenylpropyl)phosphinic acid.
| Compound Name | [(2R)-1-[[(2S,3S,5R)-6-(butylamino)-1-cyclohexyl-3-hydroxy-5-methyl-6-oxohexan-2-yl]amino]-1-oxopropan-2-yl]oxy-(3-phenylpropyl)phosphinic acid |
|---|---|
| PubChem CID | 10099128 |
| Molecular Formula | C29H49N2O6P |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | [(2R)-1-[[(2S,3S,5R)-6-(butylamino)-1-cyclohexyl-3-hydroxy-5-methyl-6-oxohexan-2-yl]amino]-1-oxopropan-2-yl]oxy-(3-phenylpropyl)phosphinic acid |
| SMILES | CCCCNC(=O)[C@H](C)C[C@H](O)[C@H](CC1CCCCC1)NC(=O)[C@@H](C)OP(=O)(O)CCCc1ccccc1 |
| InChI | InChI=1S/C29H49N2O6P/c1-4-5-18-30-28(33)22(2)20-27(32)26(21-25-15-10-7-11-16-25)31-29(34)23(3)37-38(35,36)19-12-17-24-13-8-6-9-14-24/h6,8-9,13-14,22-23,25-27,32H,4-5,7,10-12,15-21H2,1-3H3,(H,30,33)(H,31,34)(H,35,36)/t22-,23-,26+,27+/m1/s1 |
| InChIKey | MPIMSIROJYQCNO-YWUUFRFPSA-N |
| XLogP | 4.97 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|