C27H38NO4P — CID 135065871
N-tert-butyl-2-[[cyclohexyl(hydroxy)methyl]-phenylphosphoryl]oxy-4-phenylbutanamide (PubChem CID 135065871) has the molecular formula C27H38NO4P and a molecular weight of 471.58 g/mol. Its IUPAC name is N-tert-butyl-2-[[cyclohexyl(hydroxy)methyl]-phenylphosphoryl]oxy-4-phenylbutanamide.
| Compound Name | N-tert-butyl-2-[[cyclohexyl(hydroxy)methyl]-phenylphosphoryl]oxy-4-phenylbutanamide |
|---|---|
| PubChem CID | 135065871 |
| Molecular Formula | C27H38NO4P |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | N-tert-butyl-2-[[cyclohexyl(hydroxy)methyl]-phenylphosphoryl]oxy-4-phenylbutanamide |
| SMILES | CC(C)(C)NC(=O)C(CCc1ccccc1)OP(=O)(c1ccccc1)C(O)C1CCCCC1 |
| InChI | InChI=1S/C27H38NO4P/c1-27(2,3)28-25(29)24(20-19-21-13-7-4-8-14-21)32-33(31,23-17-11-6-12-18-23)26(30)22-15-9-5-10-16-22/h4,6-8,11-14,17-18,22,24,26,30H,5,9-10,15-16,19-20H2,1-3H3,(H,28,29) |
| InChIKey | FQXHIDHWGNAXDW-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|