C20H25NO3P+ — CID 135064192
[1-(tert-butylamino)-1-oxo-4-phenylbutan-2-yl]oxy-oxo-phenylphosphanium (PubChem CID 135064192) has the molecular formula C20H25NO3P+ and a molecular weight of 358.40 g/mol. Its IUPAC name is [1-(tert-butylamino)-1-oxo-4-phenylbutan-2-yl]oxy-oxo-phenylphosphanium.
| Compound Name | [1-(tert-butylamino)-1-oxo-4-phenylbutan-2-yl]oxy-oxo-phenylphosphanium |
|---|---|
| PubChem CID | 135064192 |
| Molecular Formula | C20H25NO3P+ |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | [1-(tert-butylamino)-1-oxo-4-phenylbutan-2-yl]oxy-oxo-phenylphosphanium |
| SMILES | CC(C)(C)NC(=O)C(CCc1ccccc1)O[P+](=O)c1ccccc1 |
| InChI | InChI=1S/C20H24NO3P/c1-20(2,3)21-19(22)18(15-14-16-10-6-4-7-11-16)24-25(23)17-12-8-5-9-13-17/h4-13,18H,14-15H2,1-3H3/p+1 |
| InChIKey | UBYXKJDJTUQZDD-UHFFFAOYSA-O |
| XLogP | 3.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|