C25H34NO4P — CID 135065872
N-tert-butyl-2-cyclohexyl-2-[[hydroxy(phenyl)methyl]-phenylphosphoryl]oxyacetamide (PubChem CID 135065872) has the molecular formula C25H34NO4P and a molecular weight of 443.52 g/mol. Its IUPAC name is N-tert-butyl-2-cyclohexyl-2-[[hydroxy(phenyl)methyl]-phenylphosphoryl]oxyacetamide.
| Compound Name | N-tert-butyl-2-cyclohexyl-2-[[hydroxy(phenyl)methyl]-phenylphosphoryl]oxyacetamide |
|---|---|
| PubChem CID | 135065872 |
| Molecular Formula | C25H34NO4P |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | N-tert-butyl-2-cyclohexyl-2-[[hydroxy(phenyl)methyl]-phenylphosphoryl]oxyacetamide |
| SMILES | CC(C)(C)NC(=O)C(OP(=O)(c1ccccc1)C(O)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C25H34NO4P/c1-25(2,3)26-23(27)22(19-13-7-4-8-14-19)30-31(29,21-17-11-6-12-18-21)24(28)20-15-9-5-10-16-20/h5-6,9-12,15-19,22,24,28H,4,7-8,13-14H2,1-3H3,(H,26,27) |
| InChIKey | YMWBVOGBQDSVHE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|