C27H31ClNO4P — CID 122214537
N-tert-butyl-2-[[(2-chlorophenyl)-hydroxymethyl]-phenylphosphoryl]oxy-4-phenylbutanamide (PubChem CID 122214537) has the molecular formula C27H31ClNO4P and a molecular weight of 499.98 g/mol. Its IUPAC name is N-tert-butyl-2-[[(2-chlorophenyl)-hydroxymethyl]-phenylphosphoryl]oxy-4-phenylbutanamide.
| Compound Name | N-tert-butyl-2-[[(2-chlorophenyl)-hydroxymethyl]-phenylphosphoryl]oxy-4-phenylbutanamide |
|---|---|
| PubChem CID | 122214537 |
| Molecular Formula | C27H31ClNO4P |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N-tert-butyl-2-[[(2-chlorophenyl)-hydroxymethyl]-phenylphosphoryl]oxy-4-phenylbutanamide |
| SMILES | CC(C)(C)NC(=O)C(CCc1ccccc1)OP(=O)(c1ccccc1)C(O)c1ccccc1Cl |
| InChI | InChI=1S/C27H31ClNO4P/c1-27(2,3)29-25(30)24(19-18-20-12-6-4-7-13-20)33-34(32,21-14-8-5-9-15-21)26(31)22-16-10-11-17-23(22)28/h4-17,24,26,31H,18-19H2,1-3H3,(H,29,30) |
| InChIKey | RKXZGIQREYDZIZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|