C43H51NO3Si2 — CID 102046472
N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]-4-phenyl-2-triphenylsilyloxybutanamide (PubChem CID 102046472) has the molecular formula C43H51NO3Si2 and a molecular weight of 686.06 g/mol. Its IUPAC name is N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]-4-phenyl-2-triphenylsilyloxybutanamide.
| Compound Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]-4-phenyl-2-triphenylsilyloxybutanamide |
|---|---|
| PubChem CID | 102046472 |
| Molecular Formula | C43H51NO3Si2 |
| Molecular Weight | 686.06 g/mol |
| Exact Mass | 685.34 |
| IUPAC Name | N-[(2S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylpropan-2-yl]-4-phenyl-2-triphenylsilyloxybutanamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](Cc1ccccc1)NC(=O)C(CCc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H51NO3Si2/c1-43(2,3)48(4,5)46-34-37(33-36-23-13-7-14-24-36)44-42(45)41(32-31-35-21-11-6-12-22-35)47-49(38-25-15-8-16-26-38,39-27-17-9-18-28-39)40-29-19-10-20-30-40/h6-30,37,41H,31-34H2,1-5H3,(H,44,45)/t37-,41?/m0/s1 |
| InChIKey | VLBVJXYOHSJJMA-ZGLUAFTOSA-N |
| XLogP | 7.42 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.06 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|