C50H62N4O6Si — CID 58726062
(3S,6S,9S,12R)-3,6-dibenzyl-9-[(7R)-7-[tert-butyl(diphenyl)silyl]oxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone (PubChem CID 58726062) has the molecular formula C50H62N4O6Si and a molecular weight of 843.15 g/mol. Its IUPAC name is (3S,6S,9S,12R)-3,6-dibenzyl-9-[(7R)-7-[tert-butyl(diphenyl)silyl]oxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12R)-3,6-dibenzyl-9-[(7R)-7-[tert-butyl(diphenyl)silyl]oxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 58726062 |
| Molecular Formula | C50H62N4O6Si |
| Molecular Weight | 843.15 g/mol |
| Exact Mass | 842.44 |
| IUPAC Name | (3S,6S,9S,12R)-3,6-dibenzyl-9-[(7R)-7-[tert-butyl(diphenyl)silyl]oxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| SMILES | C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCCN2C(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C50H62N4O6Si/c1-36(60-61(50(2,3)4,39-26-14-7-15-27-39)40-28-16-8-17-29-40)45(55)32-19-9-18-30-41-46(56)52-42(34-37-22-10-5-11-23-37)47(57)53-43(35-38-24-12-6-13-25-38)49(59)54-33-21-20-31-44(54)48(58)51-41/h5-8,10-17,22-29,36,41-44H,9,18-21,30-35H2,1-4H3,(H,51,58)(H,52,56)(H,53,57)/t36-,41+,42+,43+,44-/m1/s1 |
| InChIKey | LWBNPWDMPDAZIZ-SQZZSABQSA-N |
| XLogP | 5.81 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.15 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|