C36H58N4O6Si — CID 71588638
(6R,9S,12R,14S)-3-benzyl-9-[(7S)-7-[tert-butyl(dimethyl)silyl]oxy-6-oxooctyl]-6-ethyl-6,14-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 71588638) has the molecular formula C36H58N4O6Si and a molecular weight of 670.97 g/mol. Its IUPAC name is (6R,9S,12R,14S)-3-benzyl-9-[(7S)-7-[tert-butyl(dimethyl)silyl]oxy-6-oxooctyl]-6-ethyl-6,14-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (6R,9S,12R,14S)-3-benzyl-9-[(7S)-7-[tert-butyl(dimethyl)silyl]oxy-6-oxooctyl]-6-ethyl-6,14-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 71588638 |
| Molecular Formula | C36H58N4O6Si |
| Molecular Weight | 670.97 g/mol |
| Exact Mass | 670.41 |
| IUPAC Name | (6R,9S,12R,14S)-3-benzyl-9-[(7S)-7-[tert-butyl(dimethyl)silyl]oxy-6-oxooctyl]-6-ethyl-6,14-dimethyl-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | CC[C@@]1(C)NC(=O)[C@H](CCCCCC(=O)[C@H](C)O[Si](C)(C)C(C)(C)C)NC(=O)[C@H]2C[C@H](C)CN2C(=O)C(Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C36H58N4O6Si/c1-10-36(7)34(45)38-28(22-26-17-13-11-14-18-26)33(44)40-23-24(2)21-29(40)32(43)37-27(31(42)39-36)19-15-12-16-20-30(41)25(3)46-47(8,9)35(4,5)6/h11,13-14,17-18,24-25,27-29H,10,12,15-16,19-23H2,1-9H3,(H,37,43)(H,38,45)(H,39,42)/t24-,25-,27-,28?,29+,36+/m0/s1 |
| InChIKey | MKYGGFOVBPJFPB-RRTGTZKVSA-N |
| XLogP | 4.66 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.97 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|