C28H40N4O5 — CID 155512972
(3S,9S,12R)-3-benzyl-6,6-dimethyl-9-[6-(oxiran-2-yl)-6-oxohexyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,11-trione (PubChem CID 155512972) has the molecular formula C28H40N4O5 and a molecular weight of 512.65 g/mol. Its IUPAC name is (3S,9S,12R)-3-benzyl-6,6-dimethyl-9-[6-(oxiran-2-yl)-6-oxohexyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,11-trione.
| Compound Name | (3S,9S,12R)-3-benzyl-6,6-dimethyl-9-[6-(oxiran-2-yl)-6-oxohexyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,11-trione |
|---|---|
| PubChem CID | 155512972 |
| Molecular Formula | C28H40N4O5 |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.30 |
| IUPAC Name | (3S,9S,12R)-3-benzyl-6,6-dimethyl-9-[6-(oxiran-2-yl)-6-oxohexyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,11-trione |
| SMILES | CC1(C)NC[C@H](CCCCCC(=O)C2CO2)NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C28H40N4O5/c1-28(2)27(36)31-21(16-19-10-5-3-6-11-19)26(35)32-15-9-13-22(32)25(34)30-20(17-29-28)12-7-4-8-14-23(33)24-18-37-24/h3,5-6,10-11,20-22,24,29H,4,7-9,12-18H2,1-2H3,(H,30,34)(H,31,36)/t20-,21-,22+,24?/m0/s1 |
| InChIKey | RVHNCNVISIEAPB-WPYSJIMHSA-N |
| XLogP | 1.49 |
| TPSA | 120.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|