C49H60N4O6Si — CID 58726424
(3S,6R,9S,12R)-3,6-dibenzyl-9-[(7R)-7-[tert-butyl(diphenyl)silyl]oxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone (PubChem CID 58726424) has the molecular formula C49H60N4O6Si and a molecular weight of 829.13 g/mol. Its IUPAC name is (3S,6R,9S,12R)-3,6-dibenzyl-9-[(7R)-7-[tert-butyl(diphenyl)silyl]oxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6R,9S,12R)-3,6-dibenzyl-9-[(7R)-7-[tert-butyl(diphenyl)silyl]oxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 58726424 |
| Molecular Formula | C49H60N4O6Si |
| Molecular Weight | 829.13 g/mol |
| Exact Mass | 828.43 |
| IUPAC Name | (3S,6R,9S,12R)-3,6-dibenzyl-9-[(7R)-7-[tert-butyl(diphenyl)silyl]oxy-6-oxooctyl]-1,4,7,10-tetrazabicyclo[10.3.0]pentadecane-2,5,8,11-tetrone |
| SMILES | C[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)CCCCC[C@@H]1NC(=O)[C@H]2CCCN2C(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C49H60N4O6Si/c1-35(59-60(49(2,3)4,38-25-14-7-15-26-38)39-27-16-8-17-28-39)44(54)31-19-9-18-29-40-45(55)51-41(33-36-21-10-5-11-22-36)46(56)52-42(34-37-23-12-6-13-24-37)48(58)53-32-20-30-43(53)47(57)50-40/h5-8,10-17,21-28,35,40-43H,9,18-20,29-34H2,1-4H3,(H,50,57)(H,51,55)(H,52,56)/t35-,40+,41-,42+,43-/m1/s1 |
| InChIKey | ZGFSDESBYHNYED-CPIMFUQQSA-N |
| XLogP | 5.42 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.13 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|