C34H47NO2Si — CID 102046468
2-[tert-butyl(diphenyl)silyl]oxy-4-phenyl-N-(2,4,4-trimethylpentan-2-yl)butanamide (PubChem CID 102046468) has the molecular formula C34H47NO2Si and a molecular weight of 529.84 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)silyl]oxy-4-phenyl-N-(2,4,4-trimethylpentan-2-yl)butanamide.
| Compound Name | 2-[tert-butyl(diphenyl)silyl]oxy-4-phenyl-N-(2,4,4-trimethylpentan-2-yl)butanamide |
|---|---|
| PubChem CID | 102046468 |
| Molecular Formula | C34H47NO2Si |
| Molecular Weight | 529.84 g/mol |
| Exact Mass | 529.34 |
| IUPAC Name | 2-[tert-butyl(diphenyl)silyl]oxy-4-phenyl-N-(2,4,4-trimethylpentan-2-yl)butanamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)C(CCc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H47NO2Si/c1-32(2,3)26-34(7,8)35-31(36)30(25-24-27-18-12-9-13-19-27)37-38(33(4,5)6,28-20-14-10-15-21-28)29-22-16-11-17-23-29/h9-23,30H,24-26H2,1-8H3,(H,35,36) |
| InChIKey | MHIHDAGIHAMAKL-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.84 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|