C18H29NO2 — CID 73064783
2-hydroxy-4-phenyl-N-(2,4,4-trimethylpentan-2-yl)butanamide (PubChem CID 73064783) has the molecular formula C18H29NO2 and a molecular weight of 291.43 g/mol. Its IUPAC name is 2-hydroxy-4-phenyl-N-(2,4,4-trimethylpentan-2-yl)butanamide.
| Compound Name | 2-hydroxy-4-phenyl-N-(2,4,4-trimethylpentan-2-yl)butanamide |
|---|---|
| PubChem CID | 73064783 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-hydroxy-4-phenyl-N-(2,4,4-trimethylpentan-2-yl)butanamide |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C18H29NO2/c1-17(2,3)13-18(4,5)19-16(21)15(20)12-11-14-9-7-6-8-10-14/h6-10,15,20H,11-13H2,1-5H3,(H,19,21) |
| InChIKey | RICQBOSCWJHQGV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |