C35H33NO2Si — CID 102046469
N-benzyl-4-phenyl-2-triphenylsilyloxybutanamide (PubChem CID 102046469) has the molecular formula C35H33NO2Si and a molecular weight of 527.74 g/mol. Its IUPAC name is N-benzyl-4-phenyl-2-triphenylsilyloxybutanamide.
| Compound Name | N-benzyl-4-phenyl-2-triphenylsilyloxybutanamide |
|---|---|
| PubChem CID | 102046469 |
| Molecular Formula | C35H33NO2Si |
| Molecular Weight | 527.74 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | N-benzyl-4-phenyl-2-triphenylsilyloxybutanamide |
| SMILES | O=C(NCc1ccccc1)C(CCc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H33NO2Si/c37-35(36-28-30-18-8-2-9-19-30)34(27-26-29-16-6-1-7-17-29)38-39(31-20-10-3-11-21-31,32-22-12-4-13-23-32)33-24-14-5-15-25-33/h1-25,34H,26-28H2,(H,36,37) |
| InChIKey | DSLDJJPYEKLPHJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.74 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|