C39H48N2O4Si — CID 10919301
(4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[(2R)-2-hydroxy-3-phenylpropanoyl]amino]-N-tritylpentanamide (PubChem CID 10919301) has the molecular formula C39H48N2O4Si and a molecular weight of 636.91 g/mol. Its IUPAC name is (4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[(2R)-2-hydroxy-3-phenylpropanoyl]amino]-N-tritylpentanamide.
| Compound Name | (4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[(2R)-2-hydroxy-3-phenylpropanoyl]amino]-N-tritylpentanamide |
|---|---|
| PubChem CID | 10919301 |
| Molecular Formula | C39H48N2O4Si |
| Molecular Weight | 636.91 g/mol |
| Exact Mass | 636.34 |
| IUPAC Name | (4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-[[(2R)-2-hydroxy-3-phenylpropanoyl]amino]-N-tritylpentanamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)[C@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C39H48N2O4Si/c1-38(2,3)46(4,5)45-29-34(40-37(44)35(42)28-30-18-10-6-11-19-30)26-27-36(43)41-39(31-20-12-7-13-21-31,32-22-14-8-15-23-32)33-24-16-9-17-25-33/h6-25,34-35,42H,26-29H2,1-5H3,(H,40,44)(H,41,43)/t34-,35+/m0/s1 |
| InChIKey | ZODPYBWBHKJOQJ-OIDHKYIRSA-N |
| XLogP | 6.99 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.91 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|