C46H46N2O2Si — CID 58680527
N,2-dibenzyl-3-[[(2S)-2-benzyl-3-(benzylamino)-3-oxopropyl]-diphenylsilyl]propanamide (PubChem CID 58680527) has the molecular formula C46H46N2O2Si and a molecular weight of 686.97 g/mol. Its IUPAC name is N,2-dibenzyl-3-[[(2S)-2-benzyl-3-(benzylamino)-3-oxopropyl]-diphenylsilyl]propanamide.
| Compound Name | N,2-dibenzyl-3-[[(2S)-2-benzyl-3-(benzylamino)-3-oxopropyl]-diphenylsilyl]propanamide |
|---|---|
| PubChem CID | 58680527 |
| Molecular Formula | C46H46N2O2Si |
| Molecular Weight | 686.97 g/mol |
| Exact Mass | 686.33 |
| IUPAC Name | N,2-dibenzyl-3-[[(2S)-2-benzyl-3-(benzylamino)-3-oxopropyl]-diphenylsilyl]propanamide |
| SMILES | O=C(NCc1ccccc1)C(Cc1ccccc1)C[Si](C[C@@H](Cc1ccccc1)C(=O)NCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H46N2O2Si/c49-45(47-33-39-23-11-3-12-24-39)41(31-37-19-7-1-8-20-37)35-51(43-27-15-5-16-28-43,44-29-17-6-18-30-44)36-42(32-38-21-9-2-10-22-38)46(50)48-34-40-25-13-4-14-26-40/h1-30,41-42H,31-36H2,(H,47,49)(H,48,50)/t41-,42?/m1/s1 |
| InChIKey | DOKDSXQFYQWTII-HRCVVWNVSA-N |
| XLogP | 7.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.97 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|