C19H22FNO4Si — CID 163935108
(3R,4R)-3-fluoro-4-[hydroxy(diphenyl)silyl]oxy-5-(methoxymethyl)-3-methylpyrrolidin-2-one (PubChem CID 163935108) has the molecular formula C19H22FNO4Si and a molecular weight of 375.47 g/mol. Its IUPAC name is (3R,4R)-3-fluoro-4-[hydroxy(diphenyl)silyl]oxy-5-(methoxymethyl)-3-methylpyrrolidin-2-one.
| Compound Name | (3R,4R)-3-fluoro-4-[hydroxy(diphenyl)silyl]oxy-5-(methoxymethyl)-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 163935108 |
| Molecular Formula | C19H22FNO4Si |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (3R,4R)-3-fluoro-4-[hydroxy(diphenyl)silyl]oxy-5-(methoxymethyl)-3-methylpyrrolidin-2-one |
| SMILES | COCC1NC(=O)[C@](C)(F)[C@@H]1O[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22FNO4Si/c1-19(20)17(16(13-24-2)21-18(19)22)25-26(23,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16-17,23H,13H2,1-2H3,(H,21,22)/t16?,17-,19-/m1/s1 |
| InChIKey | RMBIEPWULZFFRO-DOGRWBMSSA-N |
| XLogP | 0.49 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|