C17H25NO3Si — CID 10495893
(3R,4S,5R)-4-[dimethyl(phenyl)silyl]-3-[(E,1R)-1-hydroxybut-2-enyl]-5-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 10495893) has the molecular formula C17H25NO3Si and a molecular weight of 319.48 g/mol. Its IUPAC name is (3R,4S,5R)-4-[dimethyl(phenyl)silyl]-3-[(E,1R)-1-hydroxybut-2-enyl]-5-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-4-[dimethyl(phenyl)silyl]-3-[(E,1R)-1-hydroxybut-2-enyl]-5-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 10495893 |
| Molecular Formula | C17H25NO3Si |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (3R,4S,5R)-4-[dimethyl(phenyl)silyl]-3-[(E,1R)-1-hydroxybut-2-enyl]-5-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | C/C=C/[C@@H](O)[C@@H]1C(=O)N[C@H](CO)[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C17H25NO3Si/c1-4-8-14(20)15-16(13(11-19)18-17(15)21)22(2,3)12-9-6-5-7-10-12/h4-10,13-16,19-20H,11H2,1-3H3,(H,18,21)/b8-4+/t13-,14-,15+,16-/m1/s1 |
| InChIKey | DNQHQUSYWGPHEL-CJOGZJQISA-N |
| XLogP | 1.02 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|