C23H39NO3Si2 — CID 10502940
(3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[dimethyl(phenyl)silyl]-3-[(E,1R)-1-hydroxybut-2-enyl]pyrrolidin-2-one (PubChem CID 10502940) has the molecular formula C23H39NO3Si2 and a molecular weight of 433.74 g/mol. Its IUPAC name is (3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[dimethyl(phenyl)silyl]-3-[(E,1R)-1-hydroxybut-2-enyl]pyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[dimethyl(phenyl)silyl]-3-[(E,1R)-1-hydroxybut-2-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 10502940 |
| Molecular Formula | C23H39NO3Si2 |
| Molecular Weight | 433.74 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | (3R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[dimethyl(phenyl)silyl]-3-[(E,1R)-1-hydroxybut-2-enyl]pyrrolidin-2-one |
| SMILES | C/C=C/[C@@H](O)[C@@H]1C(=O)N[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H39NO3Si2/c1-9-13-19(25)20-21(28(5,6)17-14-11-10-12-15-17)18(24-22(20)26)16-27-29(7,8)23(2,3)4/h9-15,18-21,25H,16H2,1-8H3,(H,24,26)/b13-9+/t18-,19-,20+,21-/m1/s1 |
| InChIKey | HHUSJUPEXXXIBV-ILSUVWTFSA-N |
| XLogP | 4.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.74 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|