C20H33NO3Si — CID 19900152
1-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(1-hydroxyethyl)pyrrolidin-2-one (PubChem CID 19900152) has the molecular formula C20H33NO3Si and a molecular weight of 363.57 g/mol. Its IUPAC name is 1-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(1-hydroxyethyl)pyrrolidin-2-one.
| Compound Name | 1-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(1-hydroxyethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 19900152 |
| Molecular Formula | C20H33NO3Si |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 1-benzyl-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(1-hydroxyethyl)pyrrolidin-2-one |
| SMILES | CC(O)C1CC(CO[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H33NO3Si/c1-15(22)18-12-17(14-24-25(5,6)20(2,3)4)21(19(18)23)13-16-10-8-7-9-11-16/h7-11,15,17-18,22H,12-14H2,1-6H3 |
| InChIKey | HXVMWLTWZGAEHX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|