C15H23NO3Si — CID 10851289
(3R,4S,5R)-4-[dimethyl(phenyl)silyl]-3-[(1R)-1-hydroxyethyl]-5-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 10851289) has the molecular formula C15H23NO3Si and a molecular weight of 293.44 g/mol. Its IUPAC name is (3R,4S,5R)-4-[dimethyl(phenyl)silyl]-3-[(1R)-1-hydroxyethyl]-5-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-4-[dimethyl(phenyl)silyl]-3-[(1R)-1-hydroxyethyl]-5-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 10851289 |
| Molecular Formula | C15H23NO3Si |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (3R,4S,5R)-4-[dimethyl(phenyl)silyl]-3-[(1R)-1-hydroxyethyl]-5-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | C[C@@H](O)[C@@H]1C(=O)N[C@H](CO)[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C15H23NO3Si/c1-10(18)13-14(12(9-17)16-15(13)19)20(2,3)11-7-5-4-6-8-11/h4-8,10,12-14,17-18H,9H2,1-3H3,(H,16,19)/t10-,12-,13+,14-/m1/s1 |
| InChIKey | HGQYMVWSFAXUEY-RUZUBIRVSA-N |
| XLogP | 0.46 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|