C22H27NO2Si — CID 164842712
(1S,4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 164842712) has the molecular formula C22H27NO2Si and a molecular weight of 365.55 g/mol. Its IUPAC name is (1S,4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 164842712 |
| Molecular Formula | C22H27NO2Si |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (1S,4S,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1NC(=O)[C@H]2C[C@H]21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO2Si/c1-22(2,3)26(16-10-6-4-7-11-16,17-12-8-5-9-13-17)25-15-20-18-14-19(18)21(24)23-20/h4-13,18-20H,14-15H2,1-3H3,(H,23,24)/t18-,19+,20-/m1/s1 |
| InChIKey | UXLXBUGGLVWNPV-HSALFYBXSA-N |
| XLogP | 2.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|