C29H35NO2Si — CID 139660328
5-[tris[(4-methylphenyl)methyl]silyloxymethyl]pyrrolidin-2-one (PubChem CID 139660328) has the molecular formula C29H35NO2Si and a molecular weight of 457.69 g/mol. Its IUPAC name is 5-[tris[(4-methylphenyl)methyl]silyloxymethyl]pyrrolidin-2-one.
| Compound Name | 5-[tris[(4-methylphenyl)methyl]silyloxymethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 139660328 |
| Molecular Formula | C29H35NO2Si |
| Molecular Weight | 457.69 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 5-[tris[(4-methylphenyl)methyl]silyloxymethyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(C[Si](Cc2ccc(C)cc2)(Cc2ccc(C)cc2)OCC2CCC(=O)N2)cc1 |
| InChI | InChI=1S/C29H35NO2Si/c1-22-4-10-25(11-5-22)19-33(20-26-12-6-23(2)7-13-26,21-27-14-8-24(3)9-15-27)32-18-28-16-17-29(31)30-28/h4-15,28H,16-21H2,1-3H3,(H,30,31) |
| InChIKey | HNAXJAFGGUSPSA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.69 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|