C20H35NO2Si2 — CID 102184859
(3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-3,4-dimethylpyrrolidin-2-one (PubChem CID 102184859) has the molecular formula C20H35NO2Si2 and a molecular weight of 377.68 g/mol. Its IUPAC name is (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-3,4-dimethylpyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-3,4-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102184859 |
| Molecular Formula | C20H35NO2Si2 |
| Molecular Weight | 377.68 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-3,4-dimethylpyrrolidin-2-one |
| SMILES | C[C@@H]1C(=O)N[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H35NO2Si2/c1-15-17(22)21-18(23-25(8,9)19(2,3)4)20(15,5)24(6,7)16-13-11-10-12-14-16/h10-15,18H,1-9H3,(H,21,22)/t15-,18-,20+/m1/s1 |
| InChIKey | GYGQATAAFLFNLF-ZTNFWEORSA-N |
| XLogP | 4.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.68 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|