C20H25NO2Si — CID 102114828
5-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-one (PubChem CID 102114828) has the molecular formula C20H25NO2Si and a molecular weight of 339.51 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-one.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-one |
|---|---|
| PubChem CID | 102114828 |
| Molecular Formula | C20H25NO2Si |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxypyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](OC1CCC(=O)N1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NO2Si/c1-20(2,3)24(16-10-6-4-7-11-16,17-12-8-5-9-13-17)23-19-15-14-18(22)21-19/h4-13,19H,14-15H2,1-3H3,(H,21,22) |
| InChIKey | NAMPSRDFNNEDBQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|