C26H37NO2Si — CID 175969201
(5S)-1-tert-butyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylpyrrolidin-2-one (PubChem CID 175969201) has the molecular formula C26H37NO2Si and a molecular weight of 423.67 g/mol. Its IUPAC name is (5S)-1-tert-butyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylpyrrolidin-2-one.
| Compound Name | (5S)-1-tert-butyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 175969201 |
| Molecular Formula | C26H37NO2Si |
| Molecular Weight | 423.67 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (5S)-1-tert-butyl-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methylpyrrolidin-2-one |
| SMILES | CC1C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C26H37NO2Si/c1-20-18-21(27(24(20)28)25(2,3)4)19-29-30(26(5,6)7,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,20-21H,18-19H2,1-7H3/t20?,21-/m0/s1 |
| InChIKey | GJMCENZJWLOHQW-LBAQZLPGSA-N |
| XLogP | 4.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.67 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|