C19H21N3O8 — CID 118281899
ethyl 5-(ethylamino)-2-[(8-nitro-2-oxochromene-3-carbonyl)amino]-5-oxopentanoate (PubChem CID 118281899) has the molecular formula C19H21N3O8 and a molecular weight of 419.39 g/mol. Its IUPAC name is ethyl 5-(ethylamino)-2-[(8-nitro-2-oxochromene-3-carbonyl)amino]-5-oxopentanoate.
| Compound Name | ethyl 5-(ethylamino)-2-[(8-nitro-2-oxochromene-3-carbonyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 118281899 |
| Molecular Formula | C19H21N3O8 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | ethyl 5-(ethylamino)-2-[(8-nitro-2-oxochromene-3-carbonyl)amino]-5-oxopentanoate |
| SMILES | CCNC(=O)CCC(NC(=O)c1cc2cccc([N+](=O)[O-])c2oc1=O)C(=O)OCC |
| InChI | InChI=1S/C19H21N3O8/c1-3-20-15(23)9-8-13(19(26)29-4-2)21-17(24)12-10-11-6-5-7-14(22(27)28)16(11)30-18(12)25/h5-7,10,13H,3-4,8-9H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | SOIKDGONYMYKTD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 157.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|