C31H36N4O — CID 118281997
9-ethyl-6,6-dimethyl-11-methylidene-8-(4-morpholin-4-ylpiperidin-1-yl)-5H-benzo[b]carbazole-3-carbonitrile (PubChem CID 118281997) has the molecular formula C31H36N4O and a molecular weight of 480.66 g/mol. Its IUPAC name is 9-ethyl-6,6-dimethyl-11-methylidene-8-(4-morpholin-4-ylpiperidin-1-yl)-5H-benzo[b]carbazole-3-carbonitrile.
| Compound Name | 9-ethyl-6,6-dimethyl-11-methylidene-8-(4-morpholin-4-ylpiperidin-1-yl)-5H-benzo[b]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 118281997 |
| Molecular Formula | C31H36N4O |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | 9-ethyl-6,6-dimethyl-11-methylidene-8-(4-morpholin-4-ylpiperidin-1-yl)-5H-benzo[b]carbazole-3-carbonitrile |
| SMILES | C=C1c2cc(CC)c(N3CCC(N4CCOCC4)CC3)cc2C(C)(C)c2[nH]c3cc(C#N)ccc3c21 |
| InChI | InChI=1S/C31H36N4O/c1-5-22-17-25-20(2)29-24-7-6-21(19-32)16-27(24)33-30(29)31(3,4)26(25)18-28(22)35-10-8-23(9-11-35)34-12-14-36-15-13-34/h6-7,16-18,23,33H,2,5,8-15H2,1,3-4H3 |
| InChIKey | LLMIVGANWNHXRZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|