C30H34N4O2 — CID 76683997
6,6-bis(deuteriomethyl)-11-oxo-8-(2,2,6,6-tetradeuterio-4-morpholin-4-ylpiperidin-1-yl)-9-(1,1,2-trideuterioethyl)-5H-benzo[b]carbazole-3-carbonitrile (PubChem CID 76683997) has the molecular formula C30H34N4O2 and a molecular weight of 491.68 g/mol. Its IUPAC name is 6,6-bis(deuteriomethyl)-11-oxo-8-(2,2,6,6-tetradeuterio-4-morpholin-4-ylpiperidin-1-yl)-9-(1,1,2-trideuterioethyl)-5H-benzo[b]carbazole-3-carbonitrile.
| Compound Name | 6,6-bis(deuteriomethyl)-11-oxo-8-(2,2,6,6-tetradeuterio-4-morpholin-4-ylpiperidin-1-yl)-9-(1,1,2-trideuterioethyl)-5H-benzo[b]carbazole-3-carbonitrile |
|---|---|
| PubChem CID | 76683997 |
| Molecular Formula | C30H34N4O2 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.32 |
| IUPAC Name | 6,6-bis(deuteriomethyl)-11-oxo-8-(2,2,6,6-tetradeuterio-4-morpholin-4-ylpiperidin-1-yl)-9-(1,1,2-trideuterioethyl)-5H-benzo[b]carbazole-3-carbonitrile |
| SMILES | [2H]CC([2H])([2H])c1cc2c(cc1N1C([2H])([2H])CC(N3CCOCC3)CC1([2H])[2H])C(C[2H])(C[2H])c1[nH]c3cc(C#N)ccc3c1C2=O |
| InChI | InChI=1S/C30H34N4O2/c1-4-20-16-23-24(17-26(20)34-9-7-21(8-10-34)33-11-13-36-14-12-33)30(2,3)29-27(28(23)35)22-6-5-19(18-31)15-25(22)32-29/h5-6,15-17,21,32H,4,7-14H2,1-3H3/i1D,2D,3D,4D2,9D2,10D2 |
| InChIKey | KDGFLJKFZUIJMX-LJXPTAPZSA-N |
| XLogP | 4.77 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |