About 2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile
2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile (PubChem CID 11828411) has the molecular formula C29H27NP2Pt
and a molecular weight of 646.57 g/mol. Its IUPAC name is 2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile.
Molecular Properties
| Compound Name | 2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile |
| PubChem CID | 11828411 |
| Molecular Formula | C29H27NP2Pt |
| Molecular Weight | 646.57 g/mol |
| Exact Mass | 646.13 |
| IUPAC Name | 2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile |
| SMILES | C=CC#N.[Pt].c1ccc(P(CCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24P2.C3H3N.Pt/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;1-2-3-4;/h1-20H,21-22H2;2H,1H2; |
| InChIKey | RTNYCRPCVIXYIY-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 646.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile?
The IUPAC name of 2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile (CID 11828411) is 2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile.
What is the SMILES notation for 2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile?
The canonical SMILES for 2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile is C=CC#N.[Pt].c1ccc(P(CCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile?
The InChIKey is RTNYCRPCVIXYIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24P2.C3H3N.Pt/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;1-2-3-4;/h1-20H,21-22H2;2H,1H2;.
What are the key properties of 2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile?
2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile has a molecular weight of 646.57 g/mol, XLogP of 5.95, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diphenylphosphanylethyl(diphenyl)phosphane;platinum;prop-2-enenitrile is sourced from PubChem (CID 11828411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).