C14H21N — CID 118284741
1-methyl-3-(4-propan-2-ylphenyl)pyrrolidine (PubChem CID 118284741) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-methyl-3-(4-propan-2-ylphenyl)pyrrolidine.
| Compound Name | 1-methyl-3-(4-propan-2-ylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 118284741 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1-methyl-3-(4-propan-2-ylphenyl)pyrrolidine |
| SMILES | CC(C)c1ccc(C2CCN(C)C2)cc1 |
| InChI | InChI=1S/C14H21N/c1-11(2)12-4-6-13(7-5-12)14-8-9-15(3)10-14/h4-7,11,14H,8-10H2,1-3H3 |
| InChIKey | PVBPLJUOEIHFSB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |