C18H31N — CID 176679187
ethane;1-ethyl-4-(4-propan-2-ylphenyl)piperidine (PubChem CID 176679187) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is ethane;1-ethyl-4-(4-propan-2-ylphenyl)piperidine.
| Compound Name | ethane;1-ethyl-4-(4-propan-2-ylphenyl)piperidine |
|---|---|
| PubChem CID | 176679187 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | ethane;1-ethyl-4-(4-propan-2-ylphenyl)piperidine |
| SMILES | CC.CCN1CCC(c2ccc(C(C)C)cc2)CC1 |
| InChI | InChI=1S/C16H25N.C2H6/c1-4-17-11-9-16(10-12-17)15-7-5-14(6-8-15)13(2)3;1-2/h5-8,13,16H,4,9-12H2,1-3H3;1-2H3 |
| InChIKey | MVTXHWLNXVDIRG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |