C19H23ClN2O5 — CID 118285144
11-chloro-9-(2-hydroxyethoxy)-N,2-dioxo-6-propan-2-yl-6,7,7a,8,11,11a-hexahydrobenzo[a]quinolizine-3-carboxamide (PubChem CID 118285144) has the molecular formula C19H23ClN2O5 and a molecular weight of 394.86 g/mol. Its IUPAC name is 11-chloro-9-(2-hydroxyethoxy)-N,2-dioxo-6-propan-2-yl-6,7,7a,8,11,11a-hexahydrobenzo[a]quinolizine-3-carboxamide.
| Compound Name | 11-chloro-9-(2-hydroxyethoxy)-N,2-dioxo-6-propan-2-yl-6,7,7a,8,11,11a-hexahydrobenzo[a]quinolizine-3-carboxamide |
|---|---|
| PubChem CID | 118285144 |
| Molecular Formula | C19H23ClN2O5 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 11-chloro-9-(2-hydroxyethoxy)-N,2-dioxo-6-propan-2-yl-6,7,7a,8,11,11a-hexahydrobenzo[a]quinolizine-3-carboxamide |
| SMILES | CC(C)C1CC2CC(OCCO)=CC(Cl)C2c2cc(=O)c(C(=O)N=O)cn21 |
| InChI | InChI=1S/C19H23ClN2O5/c1-10(2)15-6-11-5-12(27-4-3-23)7-14(20)18(11)16-8-17(24)13(9-22(15)16)19(25)21-26/h7-11,14-15,18,23H,3-6H2,1-2H3 |
| InChIKey | AIUZNCBCQPTNHH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|