C26H34N2O5 — CID 134425532
6-tert-butyl-9-heptoxy-10-methoxy-N,2-dioxo-6,7-dihydrobenzo[a]quinolizine-3-carboxamide (PubChem CID 134425532) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is 6-tert-butyl-9-heptoxy-10-methoxy-N,2-dioxo-6,7-dihydrobenzo[a]quinolizine-3-carboxamide.
| Compound Name | 6-tert-butyl-9-heptoxy-10-methoxy-N,2-dioxo-6,7-dihydrobenzo[a]quinolizine-3-carboxamide |
|---|---|
| PubChem CID | 134425532 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 6-tert-butyl-9-heptoxy-10-methoxy-N,2-dioxo-6,7-dihydrobenzo[a]quinolizine-3-carboxamide |
| SMILES | CCCCCCCOc1cc2c(cc1OC)-c1cc(=O)c(C(=O)N=O)cn1C(C(C)(C)C)C2 |
| InChI | InChI=1S/C26H34N2O5/c1-6-7-8-9-10-11-33-23-12-17-13-24(26(2,3)4)28-16-19(25(30)27-31)21(29)15-20(28)18(17)14-22(23)32-5/h12,14-16,24H,6-11,13H2,1-5H3 |
| InChIKey | FBVKMNRJQKFCEH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|