C23H29NO7S — CID 118251799
6-tert-butyl-10-methoxy-9-(3-methylsulfonylpropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid (PubChem CID 118251799) has the molecular formula C23H29NO7S and a molecular weight of 463.55 g/mol. Its IUPAC name is 6-tert-butyl-10-methoxy-9-(3-methylsulfonylpropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid.
| Compound Name | 6-tert-butyl-10-methoxy-9-(3-methylsulfonylpropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 118251799 |
| Molecular Formula | C23H29NO7S |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 6-tert-butyl-10-methoxy-9-(3-methylsulfonylpropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
| SMILES | COc1cc2c(cc1OCCCS(C)(=O)=O)CC(C(C)(C)C)n1cc(C(=O)O)c(=O)cc1-2 |
| InChI | InChI=1S/C23H29NO7S/c1-23(2,3)21-10-14-9-20(31-7-6-8-32(5,28)29)19(30-4)11-15(14)17-12-18(25)16(22(26)27)13-24(17)21/h9,11-13,21H,6-8,10H2,1-5H3,(H,26,27) |
| InChIKey | GXQXJYZDRAYALT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|