C28H30FNO5 — CID 139328831
6-tert-butyl-10-(4-fluorophenyl)-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid (PubChem CID 139328831) has the molecular formula C28H30FNO5 and a molecular weight of 479.55 g/mol. Its IUPAC name is 6-tert-butyl-10-(4-fluorophenyl)-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid.
| Compound Name | 6-tert-butyl-10-(4-fluorophenyl)-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 139328831 |
| Molecular Formula | C28H30FNO5 |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | 6-tert-butyl-10-(4-fluorophenyl)-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
| SMILES | COCCCOc1cc2c(cc1-c1ccc(F)cc1)-c1cc(=O)c(C(=O)O)cn1C(C(C)(C)C)C2 |
| InChI | InChI=1S/C28H30FNO5/c1-28(2,3)26-13-18-12-25(35-11-5-10-34-4)21(17-6-8-19(29)9-7-17)14-20(18)23-15-24(31)22(27(32)33)16-30(23)26/h6-9,12,14-16,26H,5,10-11,13H2,1-4H3,(H,32,33) |
| InChIKey | KWWYJGCTCZQDKM-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|