C30H31NO6 — CID 139328994
10-(1-benzofuran-2-yl)-6-tert-butyl-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid (PubChem CID 139328994) has the molecular formula C30H31NO6 and a molecular weight of 501.58 g/mol. Its IUPAC name is 10-(1-benzofuran-2-yl)-6-tert-butyl-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid.
| Compound Name | 10-(1-benzofuran-2-yl)-6-tert-butyl-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 139328994 |
| Molecular Formula | C30H31NO6 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | 10-(1-benzofuran-2-yl)-6-tert-butyl-9-(3-methoxypropoxy)-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
| SMILES | COCCCOc1cc2c(cc1-c1cc3ccccc3o1)-c1cc(=O)c(C(=O)O)cn1C(C(C)(C)C)C2 |
| InChI | InChI=1S/C30H31NO6/c1-30(2,3)28-14-19-13-26(36-11-7-10-35-4)21(27-12-18-8-5-6-9-25(18)37-27)15-20(19)23-16-24(32)22(29(33)34)17-31(23)28/h5-6,8-9,12-13,15-17,28H,7,10-11,14H2,1-4H3,(H,33,34) |
| InChIKey | KGHSMXWZLMYIOZ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|