C25H33NO6 — CID 118261849
(6R)-6-tert-butyl-9-(6-hydroxyhexoxy)-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid (PubChem CID 118261849) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is (6R)-6-tert-butyl-9-(6-hydroxyhexoxy)-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid.
| Compound Name | (6R)-6-tert-butyl-9-(6-hydroxyhexoxy)-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 118261849 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (6R)-6-tert-butyl-9-(6-hydroxyhexoxy)-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
| SMILES | COc1cc2c(cc1OCCCCCCO)C[C@H](C(C)(C)C)n1cc(C(=O)O)c(=O)cc1-2 |
| InChI | InChI=1S/C25H33NO6/c1-25(2,3)23-12-16-11-22(32-10-8-6-5-7-9-27)21(31-4)13-17(16)19-14-20(28)18(24(29)30)15-26(19)23/h11,13-15,23,27H,5-10,12H2,1-4H3,(H,29,30)/t23-/m1/s1 |
| InChIKey | LHDWKFFAMYKARU-HSZRJFAPSA-N |
| XLogP | 4.30 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|