C28H38N2O6 — CID 118252044
ethyl 9-(5-acetamidopentoxy)-6-tert-butyl-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 118252044) has the molecular formula C28H38N2O6 and a molecular weight of 498.62 g/mol. Its IUPAC name is ethyl 9-(5-acetamidopentoxy)-6-tert-butyl-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate.
| Compound Name | ethyl 9-(5-acetamidopentoxy)-6-tert-butyl-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 118252044 |
| Molecular Formula | C28H38N2O6 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | ethyl 9-(5-acetamidopentoxy)-6-tert-butyl-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | CCOC(=O)c1cn2c(cc1=O)-c1cc(OC)c(OCCCCCNC(C)=O)cc1CC2C(C)(C)C |
| InChI | InChI=1S/C28H38N2O6/c1-7-35-27(33)21-17-30-22(16-23(21)32)20-15-24(34-6)25(13-19(20)14-26(30)28(3,4)5)36-12-10-8-9-11-29-18(2)31/h13,15-17,26H,7-12,14H2,1-6H3,(H,29,31) |
| InChIKey | UCYWWIJEOOTPKR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|