C26H33N3O6 — CID 118285521
9-(5-acetamidopentoxy)-6-tert-butyl-10-methoxy-N,2-dioxo-6,7-dihydrobenzo[a]quinolizine-3-carboxamide (PubChem CID 118285521) has the molecular formula C26H33N3O6 and a molecular weight of 483.57 g/mol. Its IUPAC name is 9-(5-acetamidopentoxy)-6-tert-butyl-10-methoxy-N,2-dioxo-6,7-dihydrobenzo[a]quinolizine-3-carboxamide.
| Compound Name | 9-(5-acetamidopentoxy)-6-tert-butyl-10-methoxy-N,2-dioxo-6,7-dihydrobenzo[a]quinolizine-3-carboxamide |
|---|---|
| PubChem CID | 118285521 |
| Molecular Formula | C26H33N3O6 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | 9-(5-acetamidopentoxy)-6-tert-butyl-10-methoxy-N,2-dioxo-6,7-dihydrobenzo[a]quinolizine-3-carboxamide |
| SMILES | COc1cc2c(cc1OCCCCCNC(C)=O)CC(C(C)(C)C)n1cc(C(=O)N=O)c(=O)cc1-2 |
| InChI | InChI=1S/C26H33N3O6/c1-16(30)27-9-7-6-8-10-35-23-11-17-12-24(26(2,3)4)29-15-19(25(32)28-33)21(31)14-20(29)18(17)13-22(23)34-5/h11,13-15,24H,6-10,12H2,1-5H3,(H,27,30) |
| InChIKey | JOUDXZVQKSJACC-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|