C25H32INO7 — CID 156689957
6-tert-butyl-9-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid (PubChem CID 156689957) has the molecular formula C25H32INO7 and a molecular weight of 585.44 g/mol. Its IUPAC name is 6-tert-butyl-9-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid.
| Compound Name | 6-tert-butyl-9-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 156689957 |
| Molecular Formula | C25H32INO7 |
| Molecular Weight | 585.44 g/mol |
| Exact Mass | 585.12 |
| IUPAC Name | 6-tert-butyl-9-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylic acid |
| SMILES | COc1cc2c(cc1OCCOCCOCCI)CC(C(C)(C)C)n1cc(C(=O)O)c(=O)cc1-2 |
| InChI | InChI=1S/C25H32INO7/c1-25(2,3)23-12-16-11-22(34-10-9-33-8-7-32-6-5-26)21(31-4)13-17(16)19-14-20(28)18(24(29)30)15-27(19)23/h11,13-15,23H,5-10,12H2,1-4H3,(H,29,30) |
| InChIKey | CWQWQJFHAAIRHB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|