C34H43NO10S — CID 142613496
ethyl 6-tert-butyl-10-methoxy-9-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 142613496) has the molecular formula C34H43NO10S and a molecular weight of 657.78 g/mol. Its IUPAC name is ethyl 6-tert-butyl-10-methoxy-9-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate.
| Compound Name | ethyl 6-tert-butyl-10-methoxy-9-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 142613496 |
| Molecular Formula | C34H43NO10S |
| Molecular Weight | 657.78 g/mol |
| Exact Mass | 657.26 |
| IUPAC Name | ethyl 6-tert-butyl-10-methoxy-9-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | CCOC(=O)c1cn2c(cc1=O)-c1cc(OC)c(OCCOCCOCCOS(=O)(=O)c3ccc(C)cc3)cc1CC2C(C)(C)C |
| InChI | InChI=1S/C34H43NO10S/c1-7-43-33(37)27-22-35-28(21-29(27)36)26-20-30(40-6)31(18-24(26)19-32(35)34(3,4)5)44-16-14-41-12-13-42-15-17-45-46(38,39)25-10-8-23(2)9-11-25/h8-11,18,20-22,32H,7,12-17,19H2,1-6H3 |
| InChIKey | QEHHFXAMGCBDTC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 128.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.78 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|