C27H36INO7 — CID 142613520
ethyl 6-tert-butyl-9-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 142613520) has the molecular formula C27H36INO7 and a molecular weight of 613.49 g/mol. Its IUPAC name is ethyl 6-tert-butyl-9-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate.
| Compound Name | ethyl 6-tert-butyl-9-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 142613520 |
| Molecular Formula | C27H36INO7 |
| Molecular Weight | 613.49 g/mol |
| Exact Mass | 613.15 |
| IUPAC Name | ethyl 6-tert-butyl-9-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | CCOC(=O)c1cn2c(cc1=O)-c1cc(OC)c(OCCOCCOCCI)cc1CC2C(C)(C)C |
| InChI | InChI=1S/C27H36INO7/c1-6-35-26(31)20-17-29-21(16-22(20)30)19-15-23(32-5)24(13-18(19)14-25(29)27(2,3)4)36-12-11-34-10-9-33-8-7-28/h13,15-17,25H,6-12,14H2,1-5H3 |
| InChIKey | JXQXYSDNGVJWOS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 85.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|