C28H39NO5 — CID 134425751
ethyl 6-tert-butyl-9-heptoxy-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate (PubChem CID 134425751) has the molecular formula C28H39NO5 and a molecular weight of 469.62 g/mol. Its IUPAC name is ethyl 6-tert-butyl-9-heptoxy-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate.
| Compound Name | ethyl 6-tert-butyl-9-heptoxy-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
|---|---|
| PubChem CID | 134425751 |
| Molecular Formula | C28H39NO5 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | ethyl 6-tert-butyl-9-heptoxy-10-methoxy-2-oxo-6,7-dihydrobenzo[a]quinolizine-3-carboxylate |
| SMILES | CCCCCCCOc1cc2c(cc1OC)-c1cc(=O)c(C(=O)OCC)cn1C(C(C)(C)C)C2 |
| InChI | InChI=1S/C28H39NO5/c1-7-9-10-11-12-13-34-25-14-19-15-26(28(3,4)5)29-18-21(27(31)33-8-2)23(30)17-22(29)20(19)16-24(25)32-6/h14,16-18,26H,7-13,15H2,1-6H3 |
| InChIKey | TZERZJCTFYCXAM-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|